Difference between revisions of "DIPEPTIDES"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite K-HEXANOYL-COA == * common-name: ** 3-oxohexanoyl-coa * smiles: ** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite LEU-tRNAs == * common-name: ** a trnaleu == Reaction(s) known to consume the compound == * LEUCINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite K-HEXANOYL-COA ==
+
== Metabolite LEU-tRNAs ==
 
* common-name:
 
* common-name:
** 3-oxohexanoyl-coa
+
** a trnaleu
* smiles:
 
** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
 
* inchi-key:
 
** nfoyyxqavvywkv-hdrqghtbsa-j
 
* molecular-weight:
 
** 875.63
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HACD2h]]
+
* [[LEUCINE--TRNA-LIGASE-RXN]]
* [[RXN-12570]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACACT2h]]
 
* [[HACD2h]]
 
* [[RXN-12565]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxohexanoyl-coa}}
+
{{#set: common-name=a trnaleu}}
{{#set: inchi-key=inchikey=nfoyyxqavvywkv-hdrqghtbsa-j}}
 
{{#set: molecular-weight=875.63}}
 

Revision as of 08:31, 15 March 2021

Metabolite LEU-tRNAs

  • common-name:
    • a trnaleu

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality