Difference between revisions of "16S-rRNA-guanine1516"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * smiles: ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Phos-G-protein-coupled-receptors == * common-name: ** a phosphorylated g protein-coupled receptor == Reaction(s) known to consume the com...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Phos-G-protein-coupled-receptors == |
* common-name: | * common-name: | ||
| − | ** | + | ** a phosphorylated g protein-coupled receptor |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.11.16-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.11.16-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a phosphorylated g protein-coupled receptor}} |
| − | |||
| − | |||
Revision as of 08:31, 15 March 2021
Contents
Metabolite Phos-G-protein-coupled-receptors
- common-name:
- a phosphorylated g protein-coupled receptor
