Difference between revisions of "PWY0-1329"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] ==
+== Pathway PWY0-1329 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** folate
+** succinate to cytochrome bo oxidase electron transfer
-* smiles:
+== Reaction(s) found ==
-** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3))
+* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ovbpiulpvideao-lbprgkrzsa-l
+* [NoneRXN0-5268 RXN0-5268]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 439.387
+{{#set: common-name=succinate to cytochrome bo oxidase electron transfer}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[DHFOR]]
+{{#set: completion rate=0.5}}
-* [[FOLR2]]
+{{#set: nb total reaction=2}}
-* [[THFOR1]]
-* [[THFOR2]]
-== Reaction(s) known to produce the compound ==
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=folate}}
-{{#set: inchi-key=inchikey=ovbpiulpvideao-lbprgkrzsa-l}}
-{{#set: molecular-weight=439.387}}