Difference between revisions of "PWY-7734"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1308 CPD0-1308] == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o *...") |
(Created page with "Category:pathway == Pathway PWY-7734 == * taxonomic-range: ** tax-2 * common-name: ** quinoxaline-2-carboxylate biosynthesis == Reaction(s) found == * RXN-17150 == Rea...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-7734 == |
+ | * taxonomic-range: | ||
+ | ** tax-2 | ||
* common-name: | * common-name: | ||
− | ** | + | ** quinoxaline-2-carboxylate biosynthesis |
− | + | == Reaction(s) found == | |
− | * | + | * [[RXN-17150]] |
− | * | + | == Reaction(s) not found == |
− | ** | + | * [NoneRXN-17152 RXN-17152] |
− | * | + | * [NoneRXN-17154 RXN-17154] |
− | ** | + | * [NoneRXN-17148 RXN-17148] |
− | + | * [NoneRXN-17147 RXN-17147] | |
− | * [ | + | * [NoneRXN-17145 RXN-17145] |
− | = | + | * [NoneRXN-17153 RXN-17153] |
− | + | * [NoneRXN-17149 RXN-17149] | |
− | {{#set: common-name= | + | * [NoneRXN-17146 RXN-17146] |
− | {{#set: | + | * [NoneRXN-17144 RXN-17144] |
− | {{#set: | + | {{#set: taxonomic-range=tax-2}} |
+ | {{#set: common-name=quinoxaline-2-carboxylate biosynthesis}} | ||
+ | {{#set: nb reaction found=1}} | ||
+ | {{#set: completion rate=0.1}} | ||
+ | {{#set: nb total reaction=10}} |
Latest revision as of 10:57, 18 March 2021
Pathway PWY-7734
- taxonomic-range:
- tax-2
- common-name:
- quinoxaline-2-carboxylate biosynthesis
Reaction(s) found
Reaction(s) not found
- [NoneRXN-17152 RXN-17152]
- [NoneRXN-17154 RXN-17154]
- [NoneRXN-17148 RXN-17148]
- [NoneRXN-17147 RXN-17147]
- [NoneRXN-17145 RXN-17145]
- [NoneRXN-17153 RXN-17153]
- [NoneRXN-17149 RXN-17149]
- [NoneRXN-17146 RXN-17146]
- [NoneRXN-17144 RXN-17144]