Difference between revisions of "PWY-5436"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key:...") |
(Created page with "Category:pathway == Pathway PWY-5436 == * taxonomic-range: ** tax-2 ** tax-4751 * common-name: ** l-threonine degradation iv == Reaction(s) found == * THREONINE-ALDOLASE...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-5436 == |
+ | * taxonomic-range: | ||
+ | ** tax-2 | ||
+ | ** tax-4751 | ||
* common-name: | * common-name: | ||
− | ** l- | + | ** l-threonine degradation iv |
− | + | == Reaction(s) found == | |
− | + | * [[THREONINE-ALDOLASE-RXN]] | |
− | + | == Reaction(s) not found == | |
− | + | * [NoneACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN] | |
− | + | {{#set: taxonomic-range=tax-4751|tax-2}} | |
− | + | {{#set: common-name=l-threonine degradation iv}} | |
− | == Reaction(s) | + | {{#set: nb reaction found=1}} |
− | * [[ | + | {{#set: completion rate=0.5}} |
− | + | {{#set: nb total reaction=2}} | |
− | |||
− | == Reaction(s) | ||
− | * [ | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name=l- | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 10:57, 18 March 2021
Pathway PWY-5436
- taxonomic-range:
- tax-2
- tax-4751
- common-name:
- l-threonine degradation iv
Reaction(s) found
Reaction(s) not found
- [NoneACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN]