Difference between revisions of "P101-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-TRYPTOPHAN 5-HYDROXY-TRYPTOPHAN] == * common-name: ** 5-hydroxy-l-tryptophan * smiles...")
(Created page with "Category:pathway == Pathway P101-PWY == * taxonomic-range: ** tax-2 * common-name: ** ectoine biosynthesis == Reaction(s) found == * ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-TRYPTOPHAN 5-HYDROXY-TRYPTOPHAN] ==
+
== Pathway P101-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 5-hydroxy-l-tryptophan
+
** ectoine biosynthesis
* smiles:
+
== Reaction(s) found ==
** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
+
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
* inchi-key:
+
* [[ASPARTATEKIN-RXN]]
** ldcyzajdbxycgn-vifpvbqesa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneR101-RXN R101-RXN]
** 220.227
+
* [NoneR103-RXN R103-RXN]
== Reaction(s) known to consume the compound ==
+
* [NoneR102-RXN R102-RXN]
* [[RXN3DJ-170]]
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=ectoine biosynthesis}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=2}}
{{#set: common-name=5-hydroxy-l-tryptophan}}
+
{{#set: completion rate=0.4}}
{{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}}
+
{{#set: nb total reaction=5}}
{{#set: molecular-weight=220.227}}
 

Latest revision as of 10:57, 18 March 2021

Pathway P101-PWY

  • taxonomic-range:
    • tax-2
  • common-name:
    • ectoine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneR101-RXN R101-RXN]
  • [NoneR103-RXN R103-RXN]
  • [NoneR102-RXN R102-RXN]