Difference between revisions of "P541-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * common-name: ** 3,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8083 CPD-8083] == * common-name: ** 1-18:2-2-18:3-digalactosyldiacylglycerol * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8083 CPD-8083] ==
 
* common-name:
 
* common-name:
** 3,7-dimethylurate
+
** 1-18:2-2-18:3-digalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
+
** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
 
* inchi-key:
 
* inchi-key:
** hmlzlhkhnblljd-uhfffaoysa-n
+
** gkshydzifvnlss-ipdwfasdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 196.165
+
** 939.231
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8314]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11519]]
+
* [[RXN-8313]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,7-dimethylurate}}
+
{{#set: common-name=1-18:2-2-18:3-digalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=hmlzlhkhnblljd-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=gkshydzifvnlss-ipdwfasdsa-n}}
{{#set: molecular-weight=196.165}}
+
{{#set: molecular-weight=939.231}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-8083

  • common-name:
    • 1-18:2-2-18:3-digalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
  • inchi-key:
    • gkshydzifvnlss-ipdwfasdsa-n
  • molecular-weight:
    • 939.231

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality