Difference between revisions of "GALLATE-DEGRADATION-II-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * common-name: ** inosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc...")
(Created page with "Category:pathway == Pathway GALLATE-DEGRADATION-II-PWY == * taxonomic-range: ** tax-2 * common-name: ** gallate degradation i == Reaction(s) found == * RXN-2464 == Rea...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] ==
+
== Pathway GALLATE-DEGRADATION-II-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** inosine
+
** gallate degradation i
* smiles:
+
== Reaction(s) found ==
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
* [[RXN-2464]]
* inchi-key:
+
== Reaction(s) not found ==
** ugqmrvrmyyaskq-kqynxxcusa-n
+
* [NoneRXN-2463 RXN-2463]
* molecular-weight:
+
* [NoneRXN-9983 RXN-9983]
** 268.229
+
* [NoneGALLATE-DIOXYGENASE-RXN GALLATE-DIOXYGENASE-RXN]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2}}
* [[INOPHOSPHOR-RXN]]
+
{{#set: common-name=gallate degradation i}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=1}}
* [[ADENODEAMIN-RXN]]
+
{{#set: completion rate=0.25}}
* [[I5NT]]
+
{{#set: nb total reaction=4}}
* [[INOPHOSPHOR-RXN]]
 
* [[RXN-7607]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=inosine}}
 
{{#set: inchi-key=inchikey=ugqmrvrmyyaskq-kqynxxcusa-n}}
 
{{#set: molecular-weight=268.229}}
 

Latest revision as of 10:59, 18 March 2021

Pathway GALLATE-DEGRADATION-II-PWY

  • taxonomic-range:
    • tax-2
  • common-name:
    • gallate degradation i

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-2463 RXN-2463]
  • [NoneRXN-9983 RXN-9983]
  • [NoneGALLATE-DIOXYGENASE-RXN GALLATE-DIOXYGENASE-RXN]