Difference between revisions of "PWY66-221"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Gal-Gal-Xyl-Proteins Gal-Gal-Xyl-Proteins] == * common-name: ** a [protein]-3-o-(β-d-galac...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == * common-name: ** l-thyroxine acyl β-d-glucuronide * smiles: ** c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == |
* common-name: | * common-name: | ||
− | ** | + | ** l-thyroxine acyl β-d-glucuronide |
+ | * smiles: | ||
+ | ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3))) | ||
+ | * inchi-key: | ||
+ | ** hmtfxpjobpioin-dkbymcrtsa-m | ||
+ | * molecular-weight: | ||
+ | ** 951.992 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10608]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-thyroxine acyl β-d-glucuronide}} |
+ | {{#set: inchi-key=inchikey=hmtfxpjobpioin-dkbymcrtsa-m}} | ||
+ | {{#set: molecular-weight=951.992}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-11401
- common-name:
- l-thyroxine acyl β-d-glucuronide
- smiles:
- c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
- inchi-key:
- hmtfxpjobpioin-dkbymcrtsa-m
- molecular-weight:
- 951.992