Difference between revisions of "SJ21226"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(...")
(Created page with "Category:gene == Gene SJ21226 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RIBITOL-2-DEHYDROGENASE-...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] ==
+
== Gene SJ21226 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** d-glucono-1,5-lactone
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** c(o)c1(oc(c(c(c1o)o)o)=o)
+
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** phoqvhqstubqqk-sqougzdysa-n
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
== Pathway(s) associated ==
** 178.141
+
* [[RIBITOLUTIL-PWY]]
== Reaction(s) known to consume the compound ==
+
** '''1''' reactions found over '''2''' reactions in the full pathway
* [[GLUCONOLACT-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction associated=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb pathway associated=1}}
{{#set: common-name=d-glucono-1,5-lactone}}
 
{{#set: inchi-key=inchikey=phoqvhqstubqqk-sqougzdysa-n}}
 
{{#set: molecular-weight=178.141}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ21226

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated