Difference between revisions of "SJ21995"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inc...") |
(Created page with "Category:gene == Gene SJ21995 == * transcription-direction: ** negative * right-end-position: ** 168394 * left-end-position: ** 167741 * centisome-position: ** 91.82835...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ21995 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 168394 |
− | * | + | * left-end-position: |
− | ** | + | ** 167741 |
− | * | + | * centisome-position: |
− | ** | + | ** 91.82835 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | + | == Reaction(s) associated == | |
− | == Reaction(s) | + | * [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | {{#set: transcription-direction=negative}} |
− | + | {{#set: right-end-position=168394}} | |
− | + | {{#set: left-end-position=167741}} | |
− | = | + | {{#set: centisome-position=91.82835 }} |
− | {{#set: | + | {{#set: organism associated=S.japonica_carotenoid_curated}} |
− | {{#set: | + | {{#set: nb reaction associated=1}} |
− | {{#set: |
Latest revision as of 11:03, 18 March 2021
Gene SJ21995
- transcription-direction:
- negative
- right-end-position:
- 168394
- left-end-position:
- 167741
- centisome-position:
- 91.82835
Organism(s) associated with this gene
Reaction(s) associated
- RNA-DIRECTED-DNA-POLYMERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation