Difference between revisions of "SJ11289"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14553 CPD-14553] == * common-name: ** udp-α-d-galactose * smiles: ** c(o)c1(c(o)c(o)c...")
(Created page with "Category:gene == Gene SJ11289 == * transcription-direction: ** negative * right-end-position: ** 308047 * left-end-position: ** 305444 * centisome-position: ** 38.98172...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14553 CPD-14553] ==
+
== Gene SJ11289 ==
−
* common-name:
+
* transcription-direction:
−
** udp-α-d-galactose
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
** 308047
−
* inchi-key:
+
* left-end-position:
−
** hscjrczfdfqwrp-abvwguqpsa-l
+
** 305444
−
* molecular-weight:
+
* centisome-position:
−
** 564.289
+
** 38.98172   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_carotenoid_curated]]
−
* [[2.4.1.122-RXN]]
+
== Reaction(s) associated ==
−
* [[2.4.1.123-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
−
* [[2.4.1.134-RXN]]
+
** Category: [[annotation]]
−
* [[2.4.1.151-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[2.4.1.38-RXN]]
+
{{#set: transcription-direction=negative}}
−
* [[2.4.1.46-RXN]]
+
{{#set: right-end-position=308047}}
−
* [[GALACTURIDYLYLTRANS-RXN]]
+
{{#set: left-end-position=305444}}
−
* [[LACTOSE-SYNTHASE-RXN]]
+
{{#set: centisome-position=38.98172    }}
−
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[RXN-1225]]
+
{{#set: nb reaction associated=1}}
−
* [[RXN-14561]]
 
−
* [[RXN-15276]]
 
−
* [[RXN-15277]]
 
−
* [[RXN-15278]]
 
−
* [[RXN-16027]]
 
−
* [[RXN-18266]]
 
−
* [[RXN-18302]]
 
−
* [[UDPGALtg]]
 
−
* [[UDPGALth]]
 
−
* [[UDPGLUCEPIM-RXN]]
 
−
* [[UG4E]]
 
−
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
−
</div>
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[GALACTURIDYLYLTRANS-RXN]]
 
−
* [[RXN-16027]]
 
−
* [[UDPGALtg]]
 
−
* [[UDPGALth]]
 
−
* [[UDPGLUCEPIM-RXN]]
 
−
* [[UG4E]]
 
−
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=udp-&alpha;-d-galactose}}
 
−
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-abvwguqpsa-l}}
 
−
{{#set: molecular-weight=564.289}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ11289

  • transcription-direction:
    • negative
  • right-end-position:
    • 308047
  • left-end-position:
    • 305444
  • centisome-position:
    • 38.98172

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11289&oldid=132934"