Difference between revisions of "SJ05155"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key...")
 
(Created page with "Category:gene == Gene SJ05155 == * transcription-direction: ** positive * right-end-position: ** 432205 * left-end-position: ** 412493 * centisome-position: ** 82.23725...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] ==
+
== Gene SJ05155 ==
* common-name:
+
* transcription-direction:
** l-histidine
+
** positive
* smiles:
+
* right-end-position:
** c1(nc=nc=1cc(c(=o)[o-])[n+])
+
** 432205
* inchi-key:
+
* left-end-position:
** hndvdqjcigzpno-yfkpbyrvsa-n
+
** 412493
* molecular-weight:
+
* centisome-position:
** 155.156
+
** 82.23725   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[HISTIDINE--TRNA-LIGASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[HISTIDINE-AMMONIA-LYASE-RXN]]
+
== Reaction(s) associated ==
* [[HISTIDINE-DECARBOXYLASE-RXN]]
+
* [[RXN-15559]]
* [[biomass_rxn]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[HISTALDEHYD-RXN]]
+
* [[RXN-15560]]
* [[RXN-8001]]
+
** Category: [[annotation]]
* [[RXN0-6978]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
{{#set: common-name=l-histidine}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=hndvdqjcigzpno-yfkpbyrvsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=155.156}}
+
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=432205}}
 +
{{#set: left-end-position=412493}}
 +
{{#set: centisome-position=82.23725    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ05155

  • transcription-direction:
    • positive
  • right-end-position:
    • 432205
  • left-end-position:
    • 412493
  • centisome-position:
    • 82.23725

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway