Difference between revisions of "PWY-7723"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6321 CPD-6321] == * common-name: ** a [procollagen] trans 4-hyroxy-l-proline == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * common-name: ** 1d-myo-inositol 5-monophosphate * smiles: ** c1(o)(c(o)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == |
* common-name: | * common-name: | ||
− | ** | + | ** 1d-myo-inositol 5-monophosphate |
+ | * smiles: | ||
+ | ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) | ||
+ | * inchi-key: | ||
+ | ** inapmgsxuvuwaf-kxxvrosksa-l | ||
+ | * molecular-weight: | ||
+ | ** 258.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10953]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 5-monophosphate}} |
+ | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-kxxvrosksa-l}} | ||
+ | {{#set: molecular-weight=258.121}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-6701
- common-name:
- 1d-myo-inositol 5-monophosphate
- smiles:
- c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
- inchi-key:
- inapmgsxuvuwaf-kxxvrosksa-l
- molecular-weight:
- 258.121