Difference between revisions of "PWY-3821"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-401 CPD-401] == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-IMIDAZOLEACETATE 4-IMIDAZOLEACETATE] == * common-name: ** 4-imidazoleacetate * smiles: ** c1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-401 CPD-401] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-IMIDAZOLEACETATE 4-IMIDAZOLEACETATE] ==
 
* common-name:
 
* common-name:
** anserine
+
** 4-imidazoleacetate
 
* smiles:
 
* smiles:
** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o)
+
** c1(nc=c(cc(=o)[o-])n=1)
 
* inchi-key:
 
* inchi-key:
** myyiahxivfadcu-qmmmgpobsa-n
+
** prjknhomhkjcej-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 240.261
+
** 125.107
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[X-METHYL-HIS-DIPEPTIDASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
+
* [[RXN-10089]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=anserine}}
+
{{#set: common-name=4-imidazoleacetate}}
{{#set: inchi-key=inchikey=myyiahxivfadcu-qmmmgpobsa-n}}
+
{{#set: inchi-key=inchikey=prjknhomhkjcej-uhfffaoysa-m}}
{{#set: molecular-weight=240.261}}
+
{{#set: molecular-weight=125.107}}

Revision as of 14:18, 26 August 2019

Metabolite 4-IMIDAZOLEACETATE

  • common-name:
    • 4-imidazoleacetate
  • smiles:
    • c1(nc=c(cc(=o)[o-])n=1)
  • inchi-key:
    • prjknhomhkjcej-uhfffaoysa-m
  • molecular-weight:
    • 125.107

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality