Difference between revisions of "PWY-6370"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-1354 CPD1G-1354] == * common-name: ** trehalose-trans-keto-mono-mycolate * smiles: ** ccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * common-name: ** 4'-apo-β-carotenal * smiles: ** cc(c=cc=c(c)c=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4'-apo-β-carotenal |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ftqsfezuhzhoat-brzoagjpsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 482.748 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11989]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4'-apo-β-carotenal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ftqsfezuhzhoat-brzoagjpsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=482.748}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-12935
- common-name:
- 4'-apo-β-carotenal
- smiles:
- cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
- inchi-key:
- ftqsfezuhzhoat-brzoagjpsa-n
- molecular-weight:
- 482.748
