Difference between revisions of "CPD-3486"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13083 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite CPD-3486 == * common-name: ** 3-chlorobenzoate * smiles: ** c1(c=c(cl)c=c(c=1)c(=o)[o-]) * inchi-key: ** lulayugmbfyyex-uhfffaoysa-m * mo...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-3486 == |
− | == | + | * common-name: |
− | * | + | ** 3-chlorobenzoate |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c1(c=c(cl)c=c(c=1)c(=o)[o-]) |
− | + | * inchi-key: | |
− | + | ** lulayugmbfyyex-uhfffaoysa-m | |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 155.56 |
+ | == Reaction(s) known to consume the compound == | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-9910]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=3-chlorobenzoate}} | ||
+ | {{#set: inchi-key=inchikey=lulayugmbfyyex-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=155.56}} |
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite CPD-3486
- common-name:
- 3-chlorobenzoate
- smiles:
- c1(c=c(cl)c=c(c=1)c(=o)[o-])
- inchi-key:
- lulayugmbfyyex-uhfffaoysa-m
- molecular-weight:
- 155.56