Difference between revisions of "CPD-17046"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10955 == * transcription-direction: ** positive * right-end-position: ** 259985 * left-end-position: ** 236970 * centisome-position: ** 16.405224...") |
(Created page with "Category:metabolite == Metabolite CPD-17046 == * common-name: ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))(nc(=...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-17046 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine |
| − | + | * smiles: | |
| − | + | ** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o | |
| − | + | * inchi-key: | |
| − | * | + | ** yjisldwviydioe-wgtgpsahsa-l |
| − | + | * molecular-weight: | |
| − | ** | + | ** 842.848 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-15681]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-15680]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}} | |
| − | + | {{#set: inchi-key=inchikey=yjisldwviydioe-wgtgpsahsa-l}} | |
| − | + | {{#set: molecular-weight=842.848}} | |
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-17046
- common-name:
- 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- yjisldwviydioe-wgtgpsahsa-l
- molecular-weight:
- 842.848
