Difference between revisions of "CPD-15676"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-Galactopyranose == * common-name: ** l-galactopyranose == Reaction(s) known to consume the compound == * RXN-1884 == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite CPD-15676 == * common-name: ** 6-trans-3-oxo-tridecenoyl-coa * smiles: ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15676 == |
* common-name: | * common-name: | ||
− | ** | + | ** 6-trans-3-oxo-tridecenoyl-coa |
+ | * smiles: | ||
+ | ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** fdxhxlpclxeysu-hmxwsvnbsa-j | ||
+ | * molecular-weight: | ||
+ | ** 971.802 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14788]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=6-trans-3-oxo-tridecenoyl-coa}} |
+ | {{#set: inchi-key=inchikey=fdxhxlpclxeysu-hmxwsvnbsa-j}} | ||
+ | {{#set: molecular-weight=971.802}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-15676
- common-name:
- 6-trans-3-oxo-tridecenoyl-coa
- smiles:
- ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- fdxhxlpclxeysu-hmxwsvnbsa-j
- molecular-weight:
- 971.802