Difference between revisions of "OLIGOPEPTIDES"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P == * common-name: ** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine * smiles: ** cc1(n=cc(cop(=o)([o-])...")
(Created page with "Category:metabolite == Metabolite OLIGOPEPTIDES == * common-name: ** an oligopeptide == Reaction(s) known to consume the compound == * 3.4.16.2-RXN * 3.4.21.83-RXN...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P ==
+
== Metabolite OLIGOPEPTIDES ==
 
* common-name:
 
* common-name:
** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
+
** an oligopeptide
* smiles:
 
** cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n)
 
* inchi-key:
 
** pkyfhkiyhbrtpi-uhfffaoysa-l
 
* molecular-weight:
 
** 217.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PYRIMSYN3-RXN]]
+
* [[3.4.16.2-RXN]]
 +
* [[3.4.21.83-RXN]]
 +
* [[3.4.24.70-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OHMETPYRKIN-RXN]]
 
* [[PYRIMSYN1-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}}
+
{{#set: common-name=an oligopeptide}}
{{#set: inchi-key=inchikey=pkyfhkiyhbrtpi-uhfffaoysa-l}}
 
{{#set: molecular-weight=217.121}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite OLIGOPEPTIDES

  • common-name:
    • an oligopeptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality