Difference between revisions of "OLIGOPEPTIDES"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) * inchi-key: ** gyozywvxfndglu-xlpzgreqs...") |
(Created page with "Category:metabolite == Metabolite OLIGOPEPTIDES == * common-name: ** an oligopeptide == Reaction(s) known to consume the compound == * 3.4.16.2-RXN * 3.4.21.83-RXN...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OLIGOPEPTIDES == |
* common-name: | * common-name: | ||
− | ** | + | ** an oligopeptide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.4.16.2-RXN]] |
− | * [[ | + | * [[3.4.21.83-RXN]] |
− | * [[ | + | * [[3.4.24.70-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an oligopeptide}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite OLIGOPEPTIDES
- common-name:
- an oligopeptide