Difference between revisions of "5-Phospho-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16953 == * common-name: ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin * smiles: ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) *...") |
(Created page with "Category:metabolite == Metabolite 5-Phospho-DNA == * common-name: ** a 5'-phospho-[dna] == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-5-HYDROXYL-KINAS...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-Phospho-DNA == |
* common-name: | * common-name: | ||
− | ** | + | ** a 5'-phospho-[dna] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 5'-phospho-[dna]}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 5-Phospho-DNA
- common-name:
- a 5'-phospho-[dna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-phospho-[dna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.