Difference between revisions of "MANNITOL-1P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite AMP == * common-name: ** amp * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op([o-])([o-])=o * inchi-key: ** udmbcsslthhncd-k...") |
(Created page with "Category:metabolite == Metabolite MANNITOL-1P == * common-name: ** d-mannitol 1-phosphate * smiles: ** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o * inchi-key: ** gactwzzmvmukng...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MANNITOL-1P == |
* common-name: | * common-name: | ||
− | ** | + | ** d-mannitol 1-phosphate |
* smiles: | * smiles: | ||
− | ** c | + | ** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gactwzzmvmukng-kvtdhhqdsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 260.137 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[MANNITOL-1-PHOSPHATASE-RXN]] |
− | + | * [[MANNPDEHYDROG-RXN]] | |
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[MANNPDEHYDROG-RXN]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-mannitol 1-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gactwzzmvmukng-kvtdhhqdsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=260.137}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite MANNITOL-1P
- common-name:
- d-mannitol 1-phosphate
- smiles:
- c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
- inchi-key:
- gactwzzmvmukng-kvtdhhqdsa-l
- molecular-weight:
- 260.137