Difference between revisions of "2-OCTAPRENYL-6-METHOXYPHENOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6224 == * common-name: ** gibberellin a34 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))...")
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL == * common-name: ** 2-methoxy-6-(all-trans-octaprenyl)phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6224 ==
+
== Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL ==
 
* common-name:
 
* common-name:
** gibberellin a34
+
** 2-methoxy-6-(all-trans-octaprenyl)phenol
 
* smiles:
 
* smiles:
** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** igziqajjxgrajf-oqaxfvlusa-m
+
** margkpimnmaskj-cmaxttdksa-n
 
* molecular-weight:
 
* molecular-weight:
** 347.387
+
** 669.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6550]]
+
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gibberellin a34}}
+
{{#set: common-name=2-methoxy-6-(all-trans-octaprenyl)phenol}}
{{#set: inchi-key=inchikey=igziqajjxgrajf-oqaxfvlusa-m}}
+
{{#set: inchi-key=inchikey=margkpimnmaskj-cmaxttdksa-n}}
{{#set: molecular-weight=347.387}}
+
{{#set: molecular-weight=669.085}}

Latest revision as of 11:11, 18 March 2021

Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL

  • common-name:
    • 2-methoxy-6-(all-trans-octaprenyl)phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • margkpimnmaskj-cmaxttdksa-n
  • molecular-weight:
    • 669.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality