Difference between revisions of "Cytochrome-c-arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13717 == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] * inchi-key: ** znwydqpouqrdl...") |
(Created page with "Category:metabolite == Metabolite Cytochrome-c-arginines == * common-name: ** [cytochrome c]-l-arginine == Reaction(s) known to consume the compound == * 2.1.1.124-RXN...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Cytochrome-c-arginines == |
* common-name: | * common-name: | ||
− | ** | + | ** [cytochrome c]-l-arginine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.1.1.124-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=l- | + | {{#set: common-name=[cytochrome c]-l-arginine}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Cytochrome-c-arginines
- common-name:
- [cytochrome c]-l-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "cytochrome c]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.