Difference between revisions of "PHYTOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13025 == * common-name: ** guanosine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) *...") |
(Created page with "Category:metabolite == Metabolite PHYTOL == * common-name: ** phytol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cco * inchi-key: ** botwfxyspfmfnr-pyddkjgssa-n * molecular-we...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHYTOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** phytol |
* smiles: | * smiles: | ||
| − | ** c | + | ** cc(c)cccc(c)cccc(c)cccc(c)=cco |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** botwfxyspfmfnr-pyddkjgssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 296.535 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7683]] | ||
| + | * [[RXN66-478]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phytol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=botwfxyspfmfnr-pyddkjgssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=296.535}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite PHYTOL
- common-name:
- phytol
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=cco
- inchi-key:
- botwfxyspfmfnr-pyddkjgssa-n
- molecular-weight:
- 296.535
