Difference between revisions of "CPD-14719"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12829 == * common-name: ** plastoquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(...")
(Created page with "Category:metabolite == Metabolite CPD-14719 == * common-name: ** heptadecanal * smiles: ** cccccccccccccccc[ch]=o * inchi-key: ** piydvaykybwppy-uhfffaoysa-n * molecular-w...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12829 ==
+
== Metabolite CPD-14719 ==
 
* common-name:
 
* common-name:
** plastoquinol-9
+
** heptadecanal
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c
+
** cccccccccccccccc[ch]=o
 
* inchi-key:
 
* inchi-key:
** ijbljlrewplepb-iqsnhbbhsa-n
+
** piydvaykybwppy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 751.23
+
** 254.455
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2762]]
+
* [[RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=plastoquinol-9}}
+
{{#set: common-name=heptadecanal}}
{{#set: inchi-key=inchikey=ijbljlrewplepb-iqsnhbbhsa-n}}
+
{{#set: inchi-key=inchikey=piydvaykybwppy-uhfffaoysa-n}}
{{#set: molecular-weight=751.23}}
+
{{#set: molecular-weight=254.455}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-14719

  • common-name:
    • heptadecanal
  • smiles:
    • cccccccccccccccc[ch]=o
  • inchi-key:
    • piydvaykybwppy-uhfffaoysa-n
  • molecular-weight:
    • 254.455

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality