Difference between revisions of "CPD-10660"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-490 == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o * inchi-key: ** ilxhfxfppzgenn...") |
(Created page with "Category:metabolite == Metabolite CPD-10660 == * common-name: ** 3-chlorobenzaldehyde * smiles: ** c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** srwilaksarhzpr-uhfffaoysa-n * mol...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-10660 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-chlorobenzaldehyde |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)c1(c=cc=c(cl)c=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** srwilaksarhzpr-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 140.569 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9910]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-chlorobenzaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=srwilaksarhzpr-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=140.569}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-10660
- common-name:
- 3-chlorobenzaldehyde
- smiles:
- c(=o)c1(c=cc=c(cl)c=1)
- inchi-key:
- srwilaksarhzpr-uhfffaoysa-n
- molecular-weight:
- 140.569