Difference between revisions of "CONIFERYL-ALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DOLICHOL == * common-name: ** a dolichol == Reaction(s) known to consume the compound == * DOLICHOL-KINASE-RXN == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALDEHYDE == * common-name: ** coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc=c(o)1) * inchi-key: ** dkzbbwmurdfhne-nscuhmnnsa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CONIFERYL-ALDEHYDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** coniferaldehyde |
| + | * smiles: | ||
| + | ** coc1(=cc(c=cc=o)=cc=c(o)1) | ||
| + | * inchi-key: | ||
| + | ** dkzbbwmurdfhne-nscuhmnnsa-n | ||
| + | * molecular-weight: | ||
| + | ** 178.187 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-1106]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=coniferaldehyde}} |
| + | {{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}} | ||
| + | {{#set: molecular-weight=178.187}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CONIFERYL-ALDEHYDE
- common-name:
- coniferaldehyde
- smiles:
- coc1(=cc(c=cc=o)=cc=c(o)1)
- inchi-key:
- dkzbbwmurdfhne-nscuhmnnsa-n
- molecular-weight:
- 178.187
