Difference between revisions of "CPD-8999"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER == * smiles: ** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(...") |
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * smiles: ** csccc(=o)c(=o)cop([o-])(=o)[o-] * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8999 == |
| + | * common-name: | ||
| + | ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate | ||
* smiles: | * smiles: | ||
| − | ** | + | ** csccc(=o)c(=o)cop([o-])(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** hkeaovfnwrdvaj-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 240.167 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[R145-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=hkeaovfnwrdvaj-uhfffaoysa-l}} |
| + | {{#set: molecular-weight=240.167}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-8999
- common-name:
- 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate
- smiles:
- csccc(=o)c(=o)cop([o-])(=o)[o-]
- inchi-key:
- hkeaovfnwrdvaj-uhfffaoysa-l
- molecular-weight:
- 240.167
