Difference between revisions of "SINAPOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20946 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 1.14.11.2-RXN ** Categ...") |
(Created page with "Category:metabolite == Metabolite SINAPOYL-COA == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(oc...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite SINAPOYL-COA == |
− | == | + | * common-name: |
− | + | ** sinapoyl-coa | |
− | = | + | * smiles: |
− | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | |
− | ** | + | * inchi-key: |
− | *** | + | ** rbfuwesmwrugfy-gsnioflcsa-j |
− | == | + | * molecular-weight: |
− | * [[ | + | ** 969.7 |
− | * | + | == Reaction(s) known to consume the compound == |
− | {{#set: | + | * [[RXN-1124]] |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | * [[RXN-10919]] |
+ | * [[RXN-1124]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=sinapoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}} | ||
+ | {{#set: molecular-weight=969.7}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite SINAPOYL-COA
- common-name:
- sinapoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- rbfuwesmwrugfy-gsnioflcsa-j
- molecular-weight:
- 969.7