Difference between revisions of "CPD-464"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6991 == * common-name: ** (2s)-pinocembrin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3) * inchi-key: ** urfcjeuyxna...") |
(Created page with "Category:metabolite == Metabolite CPD-464 == * common-name: ** prephytoene diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-464 == |
* common-name: | * common-name: | ||
| − | ** | + | ** prephytoene diphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rvcnktpchznaao-imslgmfesa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 719.897 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXNARA-8002]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.5.1.32-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=prephytoene diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rvcnktpchznaao-imslgmfesa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=719.897}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-464
- common-name:
- prephytoene diphosphate
- smiles:
- cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
- inchi-key:
- rvcnktpchznaao-imslgmfesa-k
- molecular-weight:
- 719.897
