Difference between revisions of "CPD-19683"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1445 == * common-name: ** l-alanyl-l-glutamate * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** vyzagtdahuirqa-whf...") |
(Created page with "Category:metabolite == Metabolite CPD-19683 == * common-name: ** an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-ace...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-19683 == |
* common-name: | * common-name: | ||
− | ** | + | ** an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15277]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-19683
- common-name:
- an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.