Difference between revisions of "CPD-10205"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-476 == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * smiles: ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o * inchi-key: ** cao...") |
(Created page with "Category:metabolite == Metabolite CPD-10205 == * common-name: ** 4-hydroxy-5-methyl-2-methylene-3(2h)-furanone * smiles: ** c=c1(c(=o)c(o)=c(c)o1) * inchi-key: ** npmqeioi...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-10205 == |
* common-name: | * common-name: | ||
− | ** 4- | + | ** 4-hydroxy-5-methyl-2-methylene-3(2h)-furanone |
* smiles: | * smiles: | ||
− | ** c | + | ** c=c1(c(=o)c(o)=c(c)o1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** npmqeioinvdlmv-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 126.112 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9563]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=4- | + | {{#set: common-name=4-hydroxy-5-methyl-2-methylene-3(2h)-furanone}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=npmqeioinvdlmv-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=126.112}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-10205
- common-name:
- 4-hydroxy-5-methyl-2-methylene-3(2h)-furanone
- smiles:
- c=c1(c(=o)c(o)=c(c)o1)
- inchi-key:
- npmqeioinvdlmv-uhfffaoysa-n
- molecular-weight:
- 126.112