Difference between revisions of "CPD-8090"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 10-FORMYL-THF == * common-name: ** 10-formyl-tetrahydrofolate mono-l-glutamate * smiles: ** c2([ch](cn(c=o)c1(c=cc(c(=o)nc(c(=o)[o-])ccc(...")
(Created page with "Category:metabolite == Metabolite CPD-8090 == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 10-FORMYL-THF ==
+
== Metabolite CPD-8090 ==
 
* common-name:
 
* common-name:
** 10-formyl-tetrahydrofolate mono-l-glutamate
+
** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
 
* smiles:
 
* smiles:
** c2([ch](cn(c=o)c1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))nc3(c(=o)nc(n)=nc(n2)=3))
+
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
* inchi-key:
** aufgtpparqzwdo-ypmhnxcesa-l
+
** qfdyidgukxrpkh-vslglsmxsa-n
 
* molecular-weight:
 
* molecular-weight:
** 471.429
+
** 780.076
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FPAIF]]
+
* [[RXN-8331]]
* [[FPGFTh]]
 
* [[FTHDF]]
 
* [[MTHFCx]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FPAIF]]
+
* [[RXN-8323]]
* [[FPGFTh]]
+
* [[RXN-8330]]
* [[FTHFL]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=10-formyl-tetrahydrofolate mono-l-glutamate}}
+
{{#set: common-name=1-α-linolenoyl-2-linoleoyl-phosphatidylcholine}}
{{#set: inchi-key=inchikey=aufgtpparqzwdo-ypmhnxcesa-l}}
+
{{#set: inchi-key=inchikey=qfdyidgukxrpkh-vslglsmxsa-n}}
{{#set: molecular-weight=471.429}}
+
{{#set: molecular-weight=780.076}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8090

  • common-name:
    • 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • qfdyidgukxrpkh-vslglsmxsa-n
  • molecular-weight:
    • 780.076

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality