Difference between revisions of "Lipoprotein-signal-peptide"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE == * common-name: ** 2-deoxy-d-glucose 6-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1) * in...")
(Created page with "Category:metabolite == Metabolite Lipoprotein-signal-peptide == * common-name: ** a lipoprotein signal peptide == Reaction(s) known to consume the compound == * RXN0-320...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE ==
+
== Metabolite Lipoprotein-signal-peptide ==
 
* common-name:
 
* common-name:
** 2-deoxy-d-glucose 6-phosphate
+
** a lipoprotein signal peptide
* smiles:
 
** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
 
* inchi-key:
 
** uqjfzaagzayvkz-cermhhmhsa-l
 
* molecular-weight:
 
** 242.122
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.68-RXN]]
+
* [[RXN0-3201]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-deoxy-d-glucose 6-phosphate}}
+
{{#set: common-name=a lipoprotein signal peptide}}
{{#set: inchi-key=inchikey=uqjfzaagzayvkz-cermhhmhsa-l}}
 
{{#set: molecular-weight=242.122}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Lipoprotein-signal-peptide

  • common-name:
    • a lipoprotein signal peptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality