Difference between revisions of "Lipoprotein-signal-peptide"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-693 == * common-name: ** 2-cis-abscisate * smiles: ** cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** jlidbldqvayhne-ykal...")
(Created page with "Category:metabolite == Metabolite Lipoprotein-signal-peptide == * common-name: ** a lipoprotein signal peptide == Reaction(s) known to consume the compound == * RXN0-320...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-693 ==
+
== Metabolite Lipoprotein-signal-peptide ==
 
* common-name:
 
* common-name:
** 2-cis-abscisate
+
** a lipoprotein signal peptide
* smiles:
 
** cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
 
* inchi-key:
 
** jlidbldqvayhne-ykalocixsa-m
 
* molecular-weight:
 
** 263.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-3201]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.2.3.14-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-cis-abscisate}}
+
{{#set: common-name=a lipoprotein signal peptide}}
{{#set: inchi-key=inchikey=jlidbldqvayhne-ykalocixsa-m}}
 
{{#set: molecular-weight=263.313}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Lipoprotein-signal-peptide

  • common-name:
    • a lipoprotein signal peptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality