Difference between revisions of "Lipoprotein-signal-peptide"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7158 == * common-name: ** 3-demethylubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cc...")
(Created page with "Category:metabolite == Metabolite Lipoprotein-signal-peptide == * common-name: ** a lipoprotein signal peptide == Reaction(s) known to consume the compound == * RXN0-320...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7158 ==
+
== Metabolite Lipoprotein-signal-peptide ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-9
+
** a lipoprotein signal peptide
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1)
 
* inchi-key:
 
** alajatogwwbpqt-nscwjznlsa-n
 
* molecular-weight:
 
** 783.228
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.64-RXN]]
+
* [[RXN0-3201]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-9}}
+
{{#set: common-name=a lipoprotein signal peptide}}
{{#set: inchi-key=inchikey=alajatogwwbpqt-nscwjznlsa-n}}
 
{{#set: molecular-weight=783.228}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Lipoprotein-signal-peptide

  • common-name:
    • a lipoprotein signal peptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality