Difference between revisions of "CPD-15686"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04660 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-15686 == * common-name: ** (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa * smiles: ** ccccccc=cc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15686 == |
− | == | + | * common-name: |
− | + | ** (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa | |
− | = | + | * smiles: |
− | + | ** ccccccc=cc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | + | * inchi-key: | |
− | + | ** zzvzpdqtnsjqpz-voxmgfccsa-j | |
− | + | * molecular-weight: | |
− | + | ** 985.829 | |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-14797]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=(3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa}} |
− | + | {{#set: inchi-key=inchikey=zzvzpdqtnsjqpz-voxmgfccsa-j}} | |
− | ** | + | {{#set: molecular-weight=985.829}} |
− | == | ||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15686
- common-name:
- (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa
- smiles:
- ccccccc=cc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- zzvzpdqtnsjqpz-voxmgfccsa-j
- molecular-weight:
- 985.829