Difference between revisions of "CPD-1137"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Poly-beta-D-Mannuronate == * common-name: ** mannuronan == Reaction(s) known to consume the compound == * RXN-9839 == Reaction(s) kno...")
(Created page with "Category:metabolite == Metabolite CPD-1137 == * common-name: ** itaconyl-coa * smiles: ** c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Poly-beta-D-Mannuronate ==
+
== Metabolite CPD-1137 ==
 
* common-name:
 
* common-name:
** mannuronan
+
** itaconyl-coa
 +
* smiles:
 +
** c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 +
* inchi-key:
 +
** nfvgylgssjprkw-citakdkdsa-i
 +
* molecular-weight:
 +
** 874.579
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9839]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALGINATE-SYNTHASE-RXN]]
+
* [[RXN-8988]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mannuronan}}
+
{{#set: common-name=itaconyl-coa}}
 +
{{#set: inchi-key=inchikey=nfvgylgssjprkw-citakdkdsa-i}}
 +
{{#set: molecular-weight=874.579}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-1137

  • common-name:
    • itaconyl-coa
  • smiles:
    • c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
  • inchi-key:
    • nfvgylgssjprkw-citakdkdsa-i
  • molecular-weight:
    • 874.579

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality