Difference between revisions of "CPD-7535"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18398 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-7535 == * common-name: ** 9,15,9'-tri-cis-ζ-carotene * smiles: ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7535 == |
− | == | + | * common-name: |
− | + | ** 9,15,9'-tri-cis-ζ-carotene | |
− | == | + | * smiles: |
− | * | + | ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c |
− | + | * inchi-key: | |
− | ** | + | ** biwlelkafxrpde-lmarsqgmsa-n |
− | * | + | * molecular-weight: |
− | + | ** 540.914 | |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-11354]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-11354]] |
− | * [[RXN- | + | * [[RXN-11355]] |
− | * | + | * [[RXN-12244]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | {{#set: common-name=9,15,9'-tri-cis-ζ-carotene}} |
− | + | {{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}} | |
− | + | {{#set: molecular-weight=540.914}} | |
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-7535
- common-name:
- 9,15,9'-tri-cis-ζ-carotene
- smiles:
- cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- biwlelkafxrpde-lmarsqgmsa-n
- molecular-weight:
- 540.914