Difference between revisions of "XYLOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-458 == * common-name: ** galactinol * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o * inchi-key: ** vcwmrqdbpzkxkg-xidcd...") |
(Created page with "Category:metabolite == Metabolite XYLOSE == * common-name: ** α-d-xylopyranose * smiles: ** c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** srbfzhdqgsbbor-lechcgjusa-n * mole...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite XYLOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-xylopyranose |
* smiles: | * smiles: | ||
− | ** | + | ** c1(oc(o)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** srbfzhdqgsbbor-lechcgjusa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 150.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.1.3.41-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-xylopyranose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=srbfzhdqgsbbor-lechcgjusa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.131}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite XYLOSE
- common-name:
- α-d-xylopyranose
- smiles:
- c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- srbfzhdqgsbbor-lechcgjusa-n
- molecular-weight:
- 150.131