Difference between revisions of "CPD-7014"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc...")
(Created page with "Category:metabolite == Metabolite CPD-7014 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTOPORPHYRINOGEN ==
+
== Metabolite CPD-7014 ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** protoporphyrinogen ix
+
** chlorophyllide b
* smiles:
 
** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
 
* inchi-key:
 
** uhsgpdmiqqynax-uhfffaoysa-l
 
 
* molecular-weight:
 
* molecular-weight:
** 566.699
+
** 626.95
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PPPGO]]
+
* [[RXN-7673]]
* [[PROTOPORGENOXI-RXN]]
+
* [[RXN-7674]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEMN-RXN]]
+
* [[RXN-13398]]
* [[RXN0-1461]]
+
* [[RXN-7673]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=protoporphyrinogen ix}}
+
{{#set: common-name=chlorophyllide b}}
{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
+
{{#set: molecular-weight=626.95}}
{{#set: molecular-weight=566.699}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-7014

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • chlorophyllide b
  • molecular-weight:
    • 626.95

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality