Difference between revisions of "5-METHYL-THF"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite 5-METHYL-THF == * common-name: ** 5-methyltetrahydrofolate mono-l-glutamate * smiles: ** cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-METHYL-THF == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-methyltetrahydrofolate mono-l-glutamate |
* smiles: | * smiles: | ||
− | ** | + | ** cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=3)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** znovtxrbgfnyrx-stqmwfeesa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 457.445 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.]] | ||
+ | * [[MTHFO]] | ||
+ | * [[MTHFO_LPAREN_nadp_RPAREN_]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-methyltetrahydrofolate mono-l-glutamate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=znovtxrbgfnyrx-stqmwfeesa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=457.445}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 5-METHYL-THF
- common-name:
- 5-methyltetrahydrofolate mono-l-glutamate
- smiles:
- cn2([ch](cnc1(=c(c(=o)nc(n)=n1)2))cnc3(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=3))
- inchi-key:
- znovtxrbgfnyrx-stqmwfeesa-l
- molecular-weight:
- 457.445