Difference between revisions of "CPD-9007"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19257 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-15117 ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-9007 == * common-name: ** adp ribose 1'',2''-cyclic phosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-9007 == |
− | == | + | * common-name: |
− | + | ** adp ribose 1'',2''-cyclic phosphate | |
− | = | + | * smiles: |
− | * | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o |
− | ** | + | * inchi-key: |
− | * | + | ** npspryxpogpcpm-tyasjmozsa-k |
− | ** | + | * molecular-weight: |
− | == | + | ** 618.26 |
− | * [[ | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | {{#set: | + | * [[2.7.1.160-RXN]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=adp ribose 1'',2''-cyclic phosphate}} |
+ | {{#set: inchi-key=inchikey=npspryxpogpcpm-tyasjmozsa-k}} | ||
+ | {{#set: molecular-weight=618.26}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-9007
- common-name:
- adp ribose 1,2-cyclic phosphate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o
- inchi-key:
- npspryxpogpcpm-tyasjmozsa-k
- molecular-weight:
- 618.26