Difference between revisions of "CPD-6741"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-Hydroxy-Terminated-DNAs == * common-name: ** a [dna]-3'-hydroxyl == Reaction(s) known to consume the compound == * DNA-LIGASE-ATP-RXN...")
(Created page with "Category:metabolite == Metabolite CPD-6741 == * common-name: ** d-myo-inositol (1,2,3,5,6) pentakisphosphate * smiles: ** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-Hydroxy-Terminated-DNAs ==
+
== Metabolite CPD-6741 ==
 
* common-name:
 
* common-name:
** a [dna]-3'-hydroxyl
+
** d-myo-inositol (1,2,3,5,6) pentakisphosphate
 +
* smiles:
 +
** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 +
* inchi-key:
 +
** ctpqaxvnygzuaj-uotptpdrsa-d
 +
* molecular-weight:
 +
** 569.977
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DNA-LIGASE-ATP-RXN]]
 
* [[DNA-LIGASE-NAD+-RXN]]
 
* [[RXN-15712]]
 
* [[RXN-15713]]
 
* [[RXN-17919]]
 
* [[RXN-17923]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7241]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [dna]-3'-hydroxyl}}
+
{{#set: common-name=d-myo-inositol (1,2,3,5,6) pentakisphosphate}}
 +
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-uotptpdrsa-d}}
 +
{{#set: molecular-weight=569.977}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-6741

  • common-name:
    • d-myo-inositol (1,2,3,5,6) pentakisphosphate
  • smiles:
    • c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • ctpqaxvnygzuaj-uotptpdrsa-d
  • molecular-weight:
    • 569.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality