Difference between revisions of "CPD-6741"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07315 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite CPD-6741 == * common-name: ** d-myo-inositol (1,2,3,5,6) pentakisphosphate * smiles: ** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op(...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-6741 == |
− | + | * common-name: | |
− | * [[ | + | ** d-myo-inositol (1,2,3,5,6) pentakisphosphate |
− | = | + | * smiles: |
− | + | ** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) | |
− | ** | + | * inchi-key: |
− | *** | + | ** ctpqaxvnygzuaj-uotptpdrsa-d |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 569.977 |
+ | == Reaction(s) known to consume the compound == | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7241]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=d-myo-inositol (1,2,3,5,6) pentakisphosphate}} | ||
+ | {{#set: inchi-key=inchikey=ctpqaxvnygzuaj-uotptpdrsa-d}} | ||
+ | {{#set: molecular-weight=569.977}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-6741
- common-name:
- d-myo-inositol (1,2,3,5,6) pentakisphosphate
- smiles:
- c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- ctpqaxvnygzuaj-uotptpdrsa-d
- molecular-weight:
- 569.977