Difference between revisions of "PYRIDOXAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite QUINATE == * common-name: ** l-quinate * smiles: ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) * inchi-key: ** aawzdtnxlsgcek-wywmibkrsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXAL == * common-name: ** pyridoxal * smiles: ** cc1(n=cc(=c(c=1o)c=o)co) * inchi-key: ** radkzdmfgjycbb-uhfffaoysa-n * molecular-we...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PYRIDOXAL == |
* common-name: | * common-name: | ||
− | ** | + | ** pyridoxal |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(n=cc(=c(c=1o)c=o)co) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** radkzdmfgjycbb-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 167.164 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[PYRIDOXINE-4-DEHYDROGENASE-RXN]] |
+ | * [[PYRIDOXKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.1.3.74-RXN]] | ||
+ | * [[PYRIDOXINE-4-DEHYDROGENASE-RXN]] | ||
+ | * [[PYRIDOXINE-4-OXIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pyridoxal}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=radkzdmfgjycbb-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=167.164}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite PYRIDOXAL
- common-name:
- pyridoxal
- smiles:
- cc1(n=cc(=c(c=1o)c=o)co)
- inchi-key:
- radkzdmfgjycbb-uhfffaoysa-n
- molecular-weight:
- 167.164