Difference between revisions of "5734-TETRAHYDROXYFLAVONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) * inchi-key: ** l...") |
(Created page with "Category:metabolite == Metabolite 5734-TETRAHYDROXYFLAVONE == * common-name: ** luteolin * smiles: ** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3))) * inchi-ke...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5734-TETRAHYDROXYFLAVONE == |
* common-name: | * common-name: | ||
− | ** | + | ** luteolin |
* smiles: | * smiles: | ||
− | ** | + | ** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** iqpnaansbpbgfq-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 285.232 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7651]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=luteolin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iqpnaansbpbgfq-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=285.232}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 5734-TETRAHYDROXYFLAVONE
- common-name:
- luteolin
- smiles:
- c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
- inchi-key:
- iqpnaansbpbgfq-uhfffaoysa-m
- molecular-weight:
- 285.232