Difference between revisions of "CPD-15370"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15015 == * common-name: ** 4-hydroxy-2-oxoglutarate == Reaction(s) known to consume the compound == * 4OH2OXOGLUTARALDOL-RXN == R...") |
(Created page with "Category:metabolite == Metabolite CPD-15370 == * common-name: ** trans-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15370 == |
* common-name: | * common-name: | ||
− | ** | + | ** trans-lesqueroloyl-coa |
+ | * smiles: | ||
+ | ** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | ||
+ | * inchi-key: | ||
+ | ** fgrjeqcmqcquqf-fscwmumrsa-j | ||
+ | * molecular-weight: | ||
+ | ** 1069.99 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14494]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=trans-lesqueroloyl-coa}} |
+ | {{#set: inchi-key=inchikey=fgrjeqcmqcquqf-fscwmumrsa-j}} | ||
+ | {{#set: molecular-weight=1069.99}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-15370
- common-name:
- trans-lesqueroloyl-coa
- smiles:
- ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- fgrjeqcmqcquqf-fscwmumrsa-j
- molecular-weight:
- 1069.99